Ketoprofen 1,3-Butylene Glycol Esters (Mixture of Regio- and Stereoisomers)
Catalog Number:
LGC-MM0001.34
| Article Name: |
Ketoprofen 1,3-Butylene Glycol Esters (Mixture of Regio- and Stereoisomers) |
| Biozol Catalog Number: |
LGC-MM0001.34 |
| Supplier Catalog Number: |
MM0001.34 |
| Alternative Catalog Number: |
LGC-MM0001.34 |
| Manufacturer: |
Mikromol |
| Category: |
Biochemikalien |
| Alternative Names: |
Ketoprofen 1,3-Butylene Glycol Ester (Mixture of Isomers) |
| Molecular Weight: |
652.77 |
| Purity: |
Available |
| Sequence: |
CC(O)CCOC(=O)C(C)c1cccc(c1)C(=O)c2ccccc2.CC(CCO)OC(=O)C(C)c3cccc(c3)C(=O)c4ccccc4 |
| Formula: |
2 C20 H22 O4 |
|
MM0001.34 |
|
MM0001.34 |