Pyridoxal 5 phosphate, CAS [[54-47-7]]

Artikelnummer: APE-B7910
Artikelname: Pyridoxal 5 phosphate, CAS [[54-47-7]]
Artikelnummer: APE-B7910
Hersteller Artikelnummer: B7910
Alternativnummer: APE-B7910-100MG,APE-B7910-500MG
Hersteller: ApexBio
Kategorie: Biochemikalien
Active form of vitamin B6 serving as a coenzyme for synthesis of amino acids, neurotransmitters (serotonin, norepinephrine), sphingolipids, aminolevulinic acid.
Molekulargewicht: 247.14
Reinheit: 0.9969
Sequenz: Cc(ncc(COP(O)(O)=O)c1C=O)c1O
CAS Nummer: [54-47-7]
Formel: C8H10NO6P