Pyridoxal 5 phosphate, CAS [[54-47-7]]
Artikelnummer:
APE-B7910
- Bilder (1)
| Artikelname: | Pyridoxal 5 phosphate, CAS [[54-47-7]] |
| Artikelnummer: | APE-B7910 |
| Hersteller Artikelnummer: | B7910 |
| Alternativnummer: | APE-B7910-100MG,APE-B7910-500MG |
| Hersteller: | ApexBio |
| Kategorie: | Biochemikalien |
| Active form of vitamin B6 serving as a coenzyme for synthesis of amino acids, neurotransmitters (serotonin, norepinephrine), sphingolipids, aminolevulinic acid. |
| Molekulargewicht: | 247.14 |
| Reinheit: | 0.9969 |
| Sequenz: | Cc(ncc(COP(O)(O)=O)c1C=O)c1O |
| CAS Nummer: | [54-47-7] |
| Formel: | C8H10NO6P |

