BM 567, CAS [[284464-77-3]]

Artikelnummer: APE-C3695
Artikelname: BM 567, CAS [[284464-77-3]]
Artikelnummer: APE-C3695
Hersteller Artikelnummer: C3695
Alternativnummer: APE-C3695-1MG,APE-C3695-5MG,APE-C3695-10MG
Hersteller: ApexBio
Kategorie: Biochemikalien
dual acting antithrombogenic agent, acting as an inhibitor of thromboxane A2 (TXA2) synthase and as an antagonist of the TP receptor
Molekulargewicht: 412.5
Reinheit: 98.00%
Sequenz: CCCCCNC(NS(c(cc(cc1)N(O)O)c1NC1CCCCC1)(=O)=O)=O
CAS Nummer: [284464-77-3]
Formel: C18H28N4O5S