CD5 Recombinant Antibody, APC-Cy7 Conjugated, APC/Cy7, Rabbit
Artikelnummer:
BSS-BSM-61094R-APC-CY7-TRIAL
| Artikelname: |
CD5 Recombinant Antibody, APC-Cy7 Conjugated, APC/Cy7, Rabbit |
| Artikelnummer: |
BSS-BSM-61094R-APC-CY7-TRIAL |
| Hersteller Artikelnummer: |
bsm-61094R-APC-Cy7 |
| Alternativnummer: |
BSS-BSM-61094R-APC-CY7-20 |
| Hersteller: |
Bioss |
| Wirt: |
Rabbit |
| Kategorie: |
Antikörper |
| Applikation: |
IF, WB |
| Spezies Reaktivität: |
Human |
| Konjugation: |
APC/Cy7 |
| Alternative Synonym: |
T-cell surface glycoprotein CD5, Lymphocyte antigen 1, Ly-1, Lyt-1, CD5 antigen, CD 5, CD5 molecule, CD5 antigen (p56 62), CD5_HUMAN, LEU 1, LEU1, Ly12, LyA, Lymphocyte Antigen CD5, Lymphocyte antigen T1/Leu 1, Lymphocyte antigen T1/Leu-1, Lymphocyte glycoprotein T1/Leu1, OTTHUMP00000236973, p56 62, T1. |
| May act as a receptor in regulating T-cell proliferation. |
| Klonalität: |
Recombinant |
| Konzentration: |
Lot dependent |
| NCBI: |
921 |
| UniProt: |
P06127 |
| Puffer: |
Aqueous buffered solution containing 0.01M TBS (pH7.4) with 1% BSA, 0.02% Proclin300 and 50% Glycerol. |
| Quelle: |
KLH conjugated synthetic peptide derived from human CD5 |
| Reinheit: |
Purified by Protein A. |
| Target-Kategorie: |
CD5 |
| Antibody Type: |
Primary Antibody |
| Application Verdünnung: |
WB(WB(1:500-2000)), IF(IHC-P)(IF(IHC-P)(1:50-200)) |