C-NH-Boc-C-Bis-(C-PEG1-Boc), CAS [[1807503-91-8]] Preis auf Anfrage
Artikelnummer:
MCE-HY-140336
| Artikelname: |
C-NH-Boc-C-Bis-(C-PEG1-Boc), CAS [[1807503-91-8]] Preis auf Anfrage |
| Artikelnummer: |
MCE-HY-140336 |
| Hersteller Artikelnummer: |
HY-140336 |
| Alternativnummer: |
MCE-HY-140336-1G,MCE-HY-140336-50MG,MCE-HY-140336-100MG,MCE-HY-140336-250MG,MCE-HY-140336-25MG |
| Hersteller: |
MedchemExpress |
| Kategorie: |
Biochemikalien |
| C-NH-Boc-C-Bis-(C-PEG1-Boc) is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Molekulargewicht: |
447.56 |
| CAS Nummer: |
[1807503-91-8] |
| Formel: |
C22H41NO8 |
| Target-Kategorie: |
PROTAC Linkers |
| Anwendungsbeschreibung: |
MCE Product type: Reference compound |