Ph-Bis(C1-N-(C2-NH-Boc)2), CAS [[1807521-06-7]] Preis auf Anfrage
Artikelnummer:
MCE-HY-140337
| Artikelname: |
Ph-Bis(C1-N-(C2-NH-Boc)2), CAS [[1807521-06-7]] Preis auf Anfrage |
| Artikelnummer: |
MCE-HY-140337 |
| Hersteller Artikelnummer: |
HY-140337 |
| Alternativnummer: |
MCE-HY-140337-50MG,MCE-HY-140337-25MG,MCE-HY-140337-100MG,MCE-HY-140337-250MG |
| Hersteller: |
MedchemExpress |
| Kategorie: |
Biochemikalien |
| Ph-Bis(C1-N-(C2-NH-Boc)2) is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Molekulargewicht: |
708.93 |
| CAS Nummer: |
[1807521-06-7] |
| Formel: |
C36H64N6O8 |
| Target-Kategorie: |
PROTAC Linkers |
| Anwendungsbeschreibung: |
MCE Product type: Reference compound |
