C-NH-Boc-C-Bis-(C1-PEG1-PFP), CAS [[1807521-01-2]] Preis auf Anfrage
Artikelnummer:
MCE-HY-141259
| Artikelname: |
C-NH-Boc-C-Bis-(C1-PEG1-PFP), CAS [[1807521-01-2]] Preis auf Anfrage |
| Artikelnummer: |
MCE-HY-141259 |
| Hersteller Artikelnummer: |
HY-141259 |
| Alternativnummer: |
MCE-HY-141259-1UNIT |
| Hersteller: |
MedchemExpress |
| Kategorie: |
Biochemikalien |
| C-NH-Boc-C-Bis-(C1-PEG1-PFP) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Molekulargewicht: |
667.45 |
| CAS Nummer: |
[1807521-01-2] |
| Formel: |
C26H23F10NO8 |
| Target-Kategorie: |
PROTAC Linkers |
| Anwendungsbeschreibung: |
MCE Product type: Reference compound |