Methohexital (Mixture of Diastereomers) - Dangerous Goods, CAS [[151-83-7]]
Artikelnummer:
TOR-M260650
- Bilder (2)
| Artikelname: | Methohexital (Mixture of Diastereomers) - Dangerous Goods, CAS [[151-83-7]] |
| Artikelnummer: | TOR-M260650 |
| Hersteller Artikelnummer: | M260650 |
| Alternativnummer: | TOR-M260650-100MG,TOR-M260650-10MG |
| Hersteller: | Toronto Research Chemicals |
| Kategorie: | Biochemikalien |
| Alternative Synonym: | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 1-methyl-5-(1-methyl-2-pentyn-1-yl)-5-(2-propen-1-yl)- (ACI), 1-Methyl-5-(1-methyl-2-pentyn-1-yl)-5-(2-propen-1-yl)-2,4,6(1H,3H,5H)-pyrimidinetrione (ACI), 2,4,6(1H,3H,5H)-Pyrimidinetrione, 1-methyl-5-(1-methyl-2-pentynyl)-5-(2-propenyl)- (9CI), Barbituric acid, 5-allyl-1-methyl-5-(1-methyl-2-pentynyl)- (6CI, 7CI, 8CI), 5-Allyl-5-(3-hexyn-2-yl)-1-methylbarbituric acid, Brevital, Brietal, Compound 22451, Compound 25398, Enallynymall, MeSH ID: D008723, Methodrexitone, Methohexital, Methohexitone |
| Molekulargewicht: | 262.3 |
| Reinheit: | >95% (HPLC) |
| Sequenz: | CCCCC(C)C1(CC=C)C(=O)NC(=O)N(C)C1=O |
| CAS Nummer: | [151-83-7] |
| Formel: | C14 H18 N2 O3 |


