N-Methyl-3-pyrrolidinyl Cyclopentylmandelate (mixture of diastereomers), CAS [[13118-11-1]] Preis auf Anfrage
Artikelnummer:
TOR-M326040
| Artikelname: |
N-Methyl-3-pyrrolidinyl Cyclopentylmandelate (mixture of diastereomers), CAS [[13118-11-1]] Preis auf Anfrage |
| Artikelnummer: |
TOR-M326040 |
| Hersteller Artikelnummer: |
M326040 |
| Alternativnummer: |
TOR-M326040-100MG,TOR-M326040-10MG |
| Hersteller: |
Toronto Research Chemicals |
| Kategorie: |
Biochemikalien |
| Alternative Synonym: |
Benzeneacetic acid, alpha-cyclopentyl-alpha-hydroxy-, 1-methyl-3-pyrrolidinyl ester, Mandelic acid, alpha-cyclopentyl-, 1-methyl-3-pyrrolidinyl ester (6CI,7CI), N-Methyl-3-pyrrolidinyl cyclopentylmandelate, 1-Methylpyrrolidin-3-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate, Glycopyrrolate Related Compound B as free base |
| Molekulargewicht: |
303.4 |
| Formulierung: |
Neat |
| Sequenz: |
CN1CCC(C1)OC(=O)C(O)(C2CCCC2)c3ccccc3 |
| CAS Nummer: |
[13118-11-1] |
| Formel: |
C18 H25 N O3 |
|
M326040 |
|
M326040 |