Brilliant Blue G, CAS [[6104-58-1]]
Artikelnummer:
APE-C5579
- Bilder (1)
| Artikelname: | Brilliant Blue G, CAS [[6104-58-1]] |
| Artikelnummer: | APE-C5579 |
| Hersteller Artikelnummer: | C5579 |
| Alternativnummer: | APE-C5579-100G |
| Hersteller: | ApexBio |
| Kategorie: | Biochemikalien |
| Alternative Synonym: | Acid Blue 90,CBBG,Coomassie Brilliant Blue G-250,NSC 328382 |
| used for protein staining in SDS-PAGE, Blue Native PAGE, and the Bradford Method, selective inhibitor of the P2X purinoceptor channel P2X7 |
| Molekulargewicht: | 854 |
| Reinheit: | 0.98 |
| Sequenz: | CC1=CC(N(CC)CC2=CC=CC(S(=O)([O-])=O)=C2)=CC=C1/C(C3=CC=C(NC4=CC=C(OCC)C=C4)C=C3)=C5C=C/C(C=C\5C)=[N+](CC6=CC=CC(S(=O)([O-])=O)=C6)/CC.[Na+] |
| CAS Nummer: | [6104-58-1] |
| Formel: | C47H48N3O7S2Na |

