Brilliant Blue G, CAS [[6104-58-1]]
Catalog Number:
APE-C5579
| Article Name: |
Brilliant Blue G, CAS [[6104-58-1]] |
| Biozol Catalog Number: |
APE-C5579 |
| Supplier Catalog Number: |
C5579 |
| Alternative Catalog Number: |
APE-C5579-100G |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
Acid Blue 90,CBBG,Coomassie Brilliant Blue G-250,NSC 328382 |
| used for protein staining in SDS-PAGE, Blue Native PAGE, and the Bradford Method, selective inhibitor of the P2X purinoceptor channel P2X7 |
| Molecular Weight: |
854 |
| Purity: |
0.98 |
| Sequence: |
CC1=CC(N(CC)CC2=CC=CC(S(=O)([O-])=O)=C2)=CC=C1/C(C3=CC=C(NC4=CC=C(OCC)C=C4)C=C3)=C5C=C/C(C=C\5C)=[N+](CC6=CC=CC(S(=O)([O-])=O)=C6)/CC.[Na+] |
| CAS Number: |
[6104-58-1] |
| Formula: |
C47H48N3O7S2Na |
