3-Methoxytyramine hydrochloride, CAS [[1477-68-5]]
Catalog Number:
AMO-M7927
| Article Name: |
3-Methoxytyramine hydrochloride, CAS [[1477-68-5]] |
| Biozol Catalog Number: |
AMO-M7927 |
| Supplier Catalog Number: |
M7927 |
| Alternative Catalog Number: |
AMO-M7927-100MG,AMO-M7927-250MG,AMO-M7927-500MG,AMO-M7927-1G |
| Manufacturer: |
Abmole Bioscience |
| Category: |
Biochemikalien |
| Alternative Names: |
3-O-methyl Dopamine hydrochloride |
| 3-Methoxytyramine hydrochloride is the major metabolite of dopamine, product of catechol O-methyltransferase. |
| Molecular Weight: |
203.67 |
| Purity: |
>98% |
| CAS Number: |
[1477-68-5] |
| Formula: |
CH3OC6H3-4-(OH)CH2CH2NH2HCl |
| Target: |
Metabolite/Endogenous Metabolite |
