KB-R7943 mesylate, CAS [[182004-65-5]]
Catalog Number:
APE-A3525
| Article Name: |
KB-R7943 mesylate, CAS [[182004-65-5]] |
| Biozol Catalog Number: |
APE-A3525 |
| Supplier Catalog Number: |
A3525 |
| Alternative Catalog Number: |
APE-A3525-10MM |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
KB-R7943, KB-R 7943 |
| Inhibitor of the reverse mode of the Na+/Ca2+ exchanger |
| Molecular Weight: |
427.5 |
| Purity: |
0.9875 |
| Sequence: |
CS(O)(=O)=O.NC(SCCc(cc1)ccc1OCc(cc1)ccc1[N+]([O-])=O)=N |
| CAS Number: |
[182004-65-5] |
| Formula: |
C17H21N3O6S2 |
