Naphthol AS-MX phosphate, CAS [[1596-56-1]]
Catalog Number:
APE-A9086
| Article Name: |
Naphthol AS-MX phosphate, CAS [[1596-56-1]] |
| Biozol Catalog Number: |
APE-A9086 |
| Supplier Catalog Number: |
A9086 |
| Alternative Catalog Number: |
APE-A9086-50MG,APE-A9086-100MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Naphthol AS-MX phosphate is a synthetic naphthol dye that is used in the diagnosis of infectious diseases, such as Klebsiella aerogenes. |
| Molecular Weight: |
371.33 |
| Purity: |
0.9943 |
| Sequence: |
Cc(cc1)cc(C)c1NC(c1cc(cccc2)c2cc1OP(O)(O)=O)=O |
| CAS Number: |
[1596-56-1] |
| Formula: |
C19H18NO5P |
