p-Cresyl sulfate potassium, CAS [[91978-69-7]]
Catalog Number:
APE-A9925
| Article Name: |
p-Cresyl sulfate potassium, CAS [[91978-69-7]] |
| Biozol Catalog Number: |
APE-A9925 |
| Supplier Catalog Number: |
A9925 |
| Alternative Catalog Number: |
APE-A9925-50MG,APE-A9925-100MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| A potassium form of p-Cresyl sulfate that acts as a pro-inflammatory agent |
| Molecular Weight: |
226.29 |
| Purity: |
0.98 |
| Sequence: |
Cc(cc1)ccc1OS([O-])(=O)=O.[K+] |
| CAS Number: |
[91978-69-7] |
| Formula: |
C7H7KO4S |
