OC000459, CAS [[851723-84-7 950688-14-9 sodium salt]]
Catalog Number:
APE-B1535
| Article Name: |
OC000459, CAS [[851723-84-7 950688-14-9 sodium salt]] |
| Biozol Catalog Number: |
APE-B1535 |
| Supplier Catalog Number: |
B1535 |
| Alternative Catalog Number: |
APE-B1535-5MG,APE-B1535-10MG,APE-B1535-25MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Antagonist of D prostanoid receptor 2 ,potent and selective |
| Molecular Weight: |
348.37 |
| Purity: |
98.00% |
| Sequence: |
Cc1c(Cc2nc(cccc3)c3cc2)c(cc(cc2)F)c2[n]1CC(O)=O |
| CAS Number: |
[851723-84-7 950688-14-9 sodium salt] |
| Formula: |
C21H17FN2O2 |
