Carboxy-PTIO, potassium salt, CAS [[148819-94-7]]
Catalog Number:
APE-B6445
| Article Name: |
Carboxy-PTIO, potassium salt, CAS [[148819-94-7]] |
| Biozol Catalog Number: |
APE-B6445 |
| Supplier Catalog Number: |
B6445 |
| Alternative Catalog Number: |
APE-B6445-10MG,APE-B6445-50MG,APE-B6445-100MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| reacts with nitric oxide to form carboxy-PTI derivatives which in turn inhibits nitric oxide synthase |
| Molecular Weight: |
315.38 |
| Sequence: |
CC(C)(C(C)(C)[N+]([O-])=C1c(cc2)ccc2C([O-])=O)N1[O].[K+] |
| CAS Number: |
[148819-94-7] |
| Formula: |
C14H16KN2O4 |
