MK 886, CAS [[118414-82-7]]
Catalog Number:
APE-B6684
| Article Name: |
MK 886, CAS [[118414-82-7]] |
| Biozol Catalog Number: |
APE-B6684 |
| Supplier Catalog Number: |
B6684 |
| Alternative Catalog Number: |
APE-B6684-5MG,APE-B6684-10MG,APE-B6684-25MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| A FLAP and PPARalpha inhibitor, capable of inhibiting leukotriene biosynthesis and inducing apoptosis |
| Molecular Weight: |
472.08 |
| Purity: |
0.9988 |
| Sequence: |
CC(C)c(cc1)cc2c1[n](Cc(cc1)ccc1Cl)c(CC(C)(C)C(O)=O)c2SC(C)(C)C |
| CAS Number: |
[118414-82-7] |
| Formula: |
C27H34ClNO2S |
