Congo Red, CAS [[573-58-0]]
Catalog Number:
APE-B7766
| Article Name: |
Congo Red, CAS [[573-58-0]] |
| Biozol Catalog Number: |
APE-B7766 |
| Supplier Catalog Number: |
B7766 |
| Alternative Catalog Number: |
APE-B7766-10MM |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| VGlut inhibitor/dye for amyloidosis,amyloid in the cell walls of plants and fungi,outer membrane of Gram-negative bacteria |
| Molecular Weight: |
696.66 |
| Purity: |
0.9838 |
| Sequence: |
[O-]S(=O)(C1=C(C=CC=C2)C2=C(C(/N=N\C3=CC=C(C=C3)C(C=C4)=CC=C4/N=N\C5=CC(S([O-])(=O)=O)=C(C=CC=C6)C6=C5N)=C1)N)=O.[Na+].[Na+] |
| CAS Number: |
[573-58-0] |
| Formula: |
C32H22N6Na2O6S2 |
