MitoSOX Red, CAS [[1003197-00-9]]
Catalog Number:
APE-B8808
| Article Name: |
MitoSOX Red, CAS [[1003197-00-9]] |
| Biozol Catalog Number: |
APE-B8808 |
| Supplier Catalog Number: |
B8808 |
| Alternative Catalog Number: |
APE-B8808-50UG,APE-B8808-1MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
Mito-HE |
| A red-fluorescent probe for the selective detection of superoxide in the mitochondria |
| Molecular Weight: |
759.70 |
| Sequence: |
NC1=CC(C(C2=CC=CC=C2)N(CCCCCC[P+](C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)C6=CC(N)=CC=C67)=C7C=C1.[I-] |
| CAS Number: |
[1003197-00-9] |
| Formula: |
C43H43IN3P |
