MAC13243 hydrochloride, CAS [[1071638-38-4]]
Catalog Number:
APE-BA1314
| Article Name: |
MAC13243 hydrochloride, CAS [[1071638-38-4]] |
| Biozol Catalog Number: |
APE-BA1314 |
| Supplier Catalog Number: |
BA1314 |
| Alternative Catalog Number: |
APE-BA1314-1ML,APE-BA1314-2MG,APE-BA1314-5MG,APE-BA1314-10MG,APE-BA1314-50MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| MAC13243 is an antimicrobial agent that is an inhibitor of bacterial lipoprotein targeting chaperones. |
| Molecular Weight: |
442.40 |
| Purity: |
98.00% |
| Sequence: |
ClC1=CC=C(CSC2=NCN(CCC3=CC(OC)=C(OC)C=C3)CN2)C=C1.Cl |
| CAS Number: |
[1071638-38-4] |
| Formula: |
C20H25Cl2N3O2S |
