LP-935509, CAS [[1454555-29-3]]
Catalog Number:
APE-BA2262
| Article Name: |
LP-935509, CAS [[1454555-29-3]] |
| Biozol Catalog Number: |
APE-BA2262 |
| Supplier Catalog Number: |
BA2262 |
| Alternative Catalog Number: |
APE-BA2262-1ML,APE-BA2262-5MG,APE-BA2262-10MG,APE-BA2262-25MG,APE-BA2262-50MG,APE-BA2262-100MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| LP-935509 is an orally potent, selective, ATP-competitive, and blood-brain barrier-crossing inhibitor of junctional protein-2-related kinase 1. |
| Molecular Weight: |
396.44 |
| Purity: |
99.97% |
| Sequence: |
O=C(OC(C)C)N1CCN(C2=NC3=C(C4=CC=CN=C4OC)C=NN3C=C2)CC1 |
| CAS Number: |
[1454555-29-3] |
| Formula: |
C20H24N6O3 |
