APTO-253, CAS [[916151-99-0]]
Catalog Number:
APE-BA2741
| Article Name: |
APTO-253, CAS [[916151-99-0]] |
| Biozol Catalog Number: |
APE-BA2741 |
| Supplier Catalog Number: |
BA2741 |
| Alternative Catalog Number: |
APE-BA2741-1ML,APE-BA2741-5MG,APE-BA2741-10MG,APE-BA2741-50MG,APE-BA2741-100MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
LOR-253,LT-253 |
| APTO-253 (LOR-253) is a small molecule that inhibits expression, stabilizes G-quadruplex DNA and induces cell cycle arrest and apoptosis in AML cells. |
| Molecular Weight: |
367.38 |
| Purity: |
97.95% |
| Sequence: |
CC1=C(C(C=C(F)C=C2)=C2N1)C(N3)=NC4=C3C5=CC=CN=C5C6=NC=CC=C64 |
| CAS Number: |
[916151-99-0] |
| Formula: |
C22H14FN5 |
