MRT-2359, CAS [[2803881-11-8]]
Catalog Number:
APE-BA2747
| Article Name: |
MRT-2359, CAS [[2803881-11-8]] |
| Biozol Catalog Number: |
APE-BA2747 |
| Supplier Catalog Number: |
BA2747 |
| Alternative Catalog Number: |
APE-BA2747-1MG,APE-BA2747-5MG,APE-BA2747-10MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| MRT-2359 is a potent, orally active and selective degrader (>30nM and <300nM) that specifically induces protein translation-dependent apoptosis. |
| Molecular Weight: |
495.38 |
| Purity: |
98.88% |
| Sequence: |
FC1=CC=C(OC(F)(F)F)C=C1NC(OCC2=CC=C3C(C(N(C4C(NC(CC4)=O)=O)C3)=O)=C2)=O |
| CAS Number: |
[2803881-11-8] |
| Formula: |
C22H17F4N3O6 |
