JKE-1674, CAS [[2421119-60-8]]
Catalog Number:
APE-BA3406
| Article Name: |
JKE-1674, CAS [[2421119-60-8]] |
| Biozol Catalog Number: |
APE-BA3406 |
| Supplier Catalog Number: |
BA3406 |
| Alternative Catalog Number: |
APE-BA3406-5MG,APE-BA3406-10MG,APE-BA3406-25MG,APE-BA3406-50MG,APE-BA3406-100MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| JKE-1674 is an orally active glutathione peroxidase 4 inhibitor and is an active metabolite of an inhibitor ML-210. |
| Molecular Weight: |
451.30 |
| Purity: |
98.00% |
| Sequence: |
O=[N+]([O-])C/C(C(N1CCN(C(C2=CC=C(Cl)C=C2)C3=CC=C(Cl)C=C3)CC1)=O)=N\O |
| CAS Number: |
[2421119-60-8] |
| Formula: |
C20H20Cl2N4O4 |
