Gamma-Mangostin, CAS [[31271-07-5]]
Catalog Number:
APE-BA4997
| Article Name: |
Gamma-Mangostin, CAS [[31271-07-5]] |
| Biozol Catalog Number: |
APE-BA4997 |
| Supplier Catalog Number: |
BA4997 |
| Alternative Catalog Number: |
APE-BA4997-1ML,APE-BA4997-5MG,APE-BA4997-10MG,APE-BA4997-20MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
gamma-Mangostin |
| Gamma-Mangostin is a novel competitive antagonist and potent inhibitor of fibrogenicity of the opsin proteins. |
| Molecular Weight: |
396.43 |
| Sequence: |
OC(C(C/C=C(C)/C)=C1O)=CC2=C1C(C3=C(O2)C=C(O)C(O)=C3C/C=C(C)/C)=O |
| CAS Number: |
[31271-07-5] |
| Formula: |
C23H24O6 |
