JZP-430, CAS [[1672691-74-5]]
Catalog Number:
APE-BA7955
| Article Name: |
JZP-430, CAS [[1672691-74-5]] |
| Biozol Catalog Number: |
APE-BA7955 |
| Supplier Catalog Number: |
BA7955 |
| Alternative Catalog Number: |
APE-BA7955-1ML,APE-BA7955-1MG,APE-BA7955-5MG,APE-BA7955-10MG,APE-BA7955-25MG,APE-BA7955-50MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| JZP-430 is a potent, highly selective and irreversible inhibitor of structural domain 6 of alpha/beta hydrolase. |
| Molecular Weight: |
354.47 |
| Purity: |
98.00% |
| Sequence: |
O=C(N(C)C1CCCCCCC1)OC2=NSN=C2N3CCOCC3 |
| CAS Number: |
[1672691-74-5] |
| Formula: |
C16H26N4O3S |
