SHMT-IN-2, CAS [[2102681-49-0]]
Catalog Number:
APE-BA8349
| Article Name: |
SHMT-IN-2, CAS [[2102681-49-0]] |
| Biozol Catalog Number: |
APE-BA8349 |
| Supplier Catalog Number: |
BA8349 |
| Alternative Catalog Number: |
APE-BA8349-1ML,APE-BA8349-1MG,APE-BA8349-5MG,APE-BA8349-10MG,APE-BA8349-25MG,APE-BA8349-50MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| SHMT-IN-2 is a specific human inhibitor with values of 13 nM and 66 nM for SHMT1 and SHMT2, respectively. |
| Molecular Weight: |
431.45 |
| Purity: |
98.85% |
| Sequence: |
CC1=NNC2=C1C(C(C)C)(C3=CC(N4CCCC4)=CC(C(F)(F)F)=C3)C(CN)=C(N)O2 |
| CAS Number: |
[2102681-49-0] |
| Formula: |
C22H24F3N5O |
