Flibanserin, CAS [[167933-07-5]]
Catalog Number:
APE-C3123
| Article Name: |
Flibanserin, CAS [[167933-07-5]] |
| Biozol Catalog Number: |
APE-C3123 |
| Supplier Catalog Number: |
C3123 |
| Alternative Catalog Number: |
APE-C3123-5MG,APE-C3123-10MG,APE-C3123-25MG,APE-C3123-50MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
BIMT 17 |
| full agonist of the serotonin 5-HT1A receptor and an antagonist of 5-HT2A. |
| Molecular Weight: |
390.4 |
| Purity: |
98.00% |
| Sequence: |
O=C1N(CCN(CC2)CCN2c2cccc(C(F)(F)F)c2)c(cccc2)c2N1 |
| CAS Number: |
[167933-07-5] |
| Formula: |
C20H21F3N4O |
