Dihydroethidium, CAS [[104821-25-2]]
Catalog Number:
APE-C3807
| Article Name: |
Dihydroethidium, CAS [[104821-25-2]] |
| Biozol Catalog Number: |
APE-C3807 |
| Supplier Catalog Number: |
C3807 |
| Alternative Catalog Number: |
APE-C3807-5MG,APE-C3807-10MG,APE-C3807-25MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Dihydroethidium (DHE), is a peroxide indicator. It penetrates cell membranes to form fluorescent protein complexes that fluoresce blue. |
| Molecular Weight: |
315.41 |
| Purity: |
0.9857 |
| Sequence: |
CCN(C1c2ccccc2)c(cc(cc2)N)c2-c(cc2)c1cc2N |
| CAS Number: |
[104821-25-2] |
| Formula: |
C21H21N3 |
