Trioxsalen, CAS [[3902-71-4]]
Catalog Number:
APE-C4451
| Article Name: |
Trioxsalen, CAS [[3902-71-4]] |
| Biozol Catalog Number: |
APE-C4451 |
| Supplier Catalog Number: |
C4451 |
| Alternative Catalog Number: |
APE-C4451-100MG,APE-C4451-250MG,APE-C4451-500MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
NSC 71047,4,5,8-Trimethylpsoralen,Trisoralen |
| intercalates into DNA and forms DNA single-strand adducts and interstrand crosslinks when activated with ultraviolet light |
| Molecular Weight: |
228.2 |
| Purity: |
98.00% |
| Sequence: |
Cc([o]c1c2C)cc1cc(C(C)=C1)c2OC1=O |
| CAS Number: |
[3902-71-4] |
| Formula: |
C14H12O3 |
