HAT Inhibitor II, CAS [[932749-62-7]]
Catalog Number:
APE-C5000
| Article Name: |
HAT Inhibitor II, CAS [[932749-62-7]] |
| Biozol Catalog Number: |
APE-C5000 |
| Supplier Catalog Number: |
C5000 |
| Alternative Catalog Number: |
APE-C5000-5MG,APE-C5000-10MG,APE-C5000-25MG,APE-C5000-50MG,APE-C5000-100MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
Histone Acetyltransferase Inhibitor II |
| inhibitor of the histone acetyltransferase p300 |
| Molecular Weight: |
464.2 |
| Purity: |
98.00% |
| Sequence: |
Oc(ccc(/C=C(\CCC/C1=C\c(cc2)cc(Br)c2O)/C/1=O)c1)c1Br |
| CAS Number: |
[932749-62-7] |
| Formula: |
C20H16Br2O3 |
