RWJ 67657, CAS [[215303-72-3]]
Catalog Number:
APE-C5316
| Article Name: |
RWJ 67657, CAS [[215303-72-3]] |
| Biozol Catalog Number: |
APE-C5316 |
| Supplier Catalog Number: |
C5316 |
| Alternative Catalog Number: |
APE-C5316-5MG,APE-C5316-10MG,APE-C5316-50MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
JNJ-3026582 |
| orally active inhibitor of the MAP kinases p38alpha and p38beta |
| Molecular Weight: |
425.5 |
| Purity: |
95.00% |
| Sequence: |
OCCCCc1nc(-c(cc2)ccc2F)c(-c2ccncc2)[n]1CCCc1ccccc1 |
| CAS Number: |
[215303-72-3] |
| Formula: |
C27H24FN3O |
