Monoacylglycerol Lipase Inhibitor 21, CAS [[1643657-35-5]]
Catalog Number:
APE-C5452
| Article Name: |
Monoacylglycerol Lipase Inhibitor 21, CAS [[1643657-35-5]] |
| Biozol Catalog Number: |
APE-C5452 |
| Supplier Catalog Number: |
C5452 |
| Alternative Catalog Number: |
APE-C5452-5MG,APE-C5452-10MG,APE-C5452-50MG,APE-C5452-100MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
MAGL Inhibitor 21,MGL Inhibitor 21 |
| inhibitor of monoacylglycerol lipase (MAGL) and FAAH |
| Molecular Weight: |
402.5 |
| Purity: |
98.00% |
| Sequence: |
O=C(CCCCCc(cc1)ccc1-c1ccccc1)OCc(cc1)cc2c1OCO2 |
| CAS Number: |
[1643657-35-5] |
| Formula: |
C26H26O4 |
