Evernic Acid, CAS [[537-09-7]]
Catalog Number:
APE-C5610
| Article Name: |
Evernic Acid, CAS [[537-09-7]] |
| Biozol Catalog Number: |
APE-C5610 |
| Supplier Catalog Number: |
C5610 |
| Alternative Catalog Number: |
APE-C5610-50MG,APE-C5610-100MG,APE-C5610-250MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
NSC 81164 |
| inhibitor of two key plasmodial FAS-II enzymes PfFabZ and PfFabI |
| Molecular Weight: |
332.3 |
| Purity: |
98.00% |
| Sequence: |
Cc1cc(OC(c(c(C)cc(OC)c2)c2O)=O)cc(O)c1C(O)=O |
| CAS Number: |
[537-09-7] |
| Formula: |
C17H16O7 |
