Ferrozine, CAS [[69898-45-9]]
Catalog Number:
APE-C8217
| Article Name: |
Ferrozine, CAS [[69898-45-9]] |
| Biozol Catalog Number: |
APE-C8217 |
| Supplier Catalog Number: |
C8217 |
| Alternative Catalog Number: |
APE-C8217-500MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Ferrozine is a reagent for the spectrophotometric determination of iron that reacts with divalent iron to form a stable magenta complex. |
| Molecular Weight: |
492.46 |
| Purity: |
96.30% |
| Sequence: |
O=S(C1=CC=C(C2=NN=C(N=C2C3=CC=C(S(O)(=O)=O)C=C3)C4=NC=CC=C4)C=C1)(O[Na])=O |
| CAS Number: |
[69898-45-9] |
| Formula: |
C20H13N4NaO6S2 |
