Cy5-DBCO, CAS [[1564286-24-3]]
Catalog Number:
APE-C8231
| Article Name: |
Cy5-DBCO, CAS [[1564286-24-3]] |
| Biozol Catalog Number: |
APE-C8231 |
| Supplier Catalog Number: |
C8231 |
| Alternative Catalog Number: |
APE-C8231-1MG,APE-C8231-5MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
DBCO-Sulfo-Cy5 |
| Cy5-DBCO (DBCO-Sulfo-Cy5) is a near-infrared (NIR) red fluorescent dye with lambda and lambda values of 646 nm and 670 nm, respectively. |
| Molecular Weight: |
1009.22 |
| Purity: |
98.00% |
| Sequence: |
O=C(N1CC2=CC=CC=C2CCC3=CC=CC=C31)CCNC(CCCCCN4/C(C(C)(C)C5=CC(S(O)(=O)=O)=CC=C54)=C\C=C\C=C\C6=[N+](CCCS([O-])(=O)=O)C7=CC=C(S(O)(=O)=O)C=C7C6(C)C)=O |
| CAS Number: |
[1564286-24-3] |
| Formula: |
C52H56N4O11S3 |
