Ostruthin, CAS [[148-83-4]]
Catalog Number:
APE-C8590
| Article Name: |
Ostruthin, CAS [[148-83-4]] |
| Biozol Catalog Number: |
APE-C8590 |
| Supplier Catalog Number: |
C8590 |
| Alternative Catalog Number: |
APE-C8590-1MG, APE-C8590-5MG, APE-C8590-10MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| A natural coumarin compound with antibacterial activity, which can effectively inhibit the growth of mycobacteria |
| Molecular Weight: |
298.38 |
| Purity: |
98.00% |
| Sequence: |
OC1=C(C/C=C(C)/CC/C=C(C)/C)C=C2C(OC(C=C2)=O)=C1 |
| CAS Number: |
[148-83-4] |
| Formula: |
C19H22O3 |
