Indigo, CAS [[482-89-3]]
Catalog Number:
APE-N1630
| Article Name: |
Indigo, CAS [[482-89-3]] |
| Biozol Catalog Number: |
APE-N1630 |
| Supplier Catalog Number: |
N1630 |
| Alternative Catalog Number: |
APE-N1630-20MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Indigo-carmine dye, which can be used as a cytoplasmic dye, often combined with picric acid |
| Molecular Weight: |
262.27 |
| Purity: |
0.98 |
| Sequence: |
O=C(c1ccccc1N1)/C\1=C1/Nc(cccc2)c2C/1=O |
| CAS Number: |
[482-89-3] |
| Formula: |
C16H10N2O2 |
