p21 Recombinant Antibody, AbBy Fluor-488 Conjugated, BF488, Rabbit
Catalog Number:
BSS-BSM-60698R-BF488
| Article Name: |
p21 Recombinant Antibody, AbBy Fluor-488 Conjugated, BF488, Rabbit |
| Biozol Catalog Number: |
BSS-BSM-60698R-BF488 |
| Supplier Catalog Number: |
bsm-60698R-BF488 |
| Alternative Catalog Number: |
BSS-BSM-60698R-BF488-100 |
| Manufacturer: |
Bioss |
| Host: |
Rabbit |
| Category: |
Antikörper |
| Application: |
FC, IF, WB |
| Species Reactivity: |
Human |
| Conjugation: |
BF488 |
| Alternative Names: |
CDN1A_HUMAN, Cyclin-dependent kinase inhibitor 1, CDKN1A, CAP20, CDKN1, CIP1, MDA6, MDA-6, PIC1, SDI1, WAF1, p21CIP1, CDK-interacting protein 1, Melanoma differentiation-associated protein 6 (MDA-6), |
| Clonality: |
Recombinant |
| Concentration: |
Lot dependent |
| NCBI: |
1026 |
| UniProt: |
P39689 |
| Buffer: |
Aqueous buffered solution containing 0.01M TBS (pH7.4) with 1% BSA, 0.02% Proclin300 and 50% Glycerol. |
| Source: |
KLH conjugated synthetic peptide derived from human p21 |
| Purity: |
Purified by Protein A. |
| Target: |
p21 |
| Antibody Type: |
Primary Antibody |
| Application Dilute: |
WB(WB(1:500-2000)), FCM(FCM(1:50-100)), IF(IHC-P)(IF(IHC-P)(1:50-200)), IF(ICC)(IF(ICC)(1:50-200)) |