CD5 Recombinant Antibody, APC Conjugated, Rabbit
Catalog Number:
BSS-BSM-61094R-APC-TRIAL
| Article Name: |
CD5 Recombinant Antibody, APC Conjugated, Rabbit |
| Biozol Catalog Number: |
BSS-BSM-61094R-APC-TRIAL |
| Supplier Catalog Number: |
bsm-61094R-APC |
| Alternative Catalog Number: |
BSS-BSM-61094R-APC-20 |
| Manufacturer: |
Bioss |
| Host: |
Rabbit |
| Category: |
Antikörper |
| Application: |
IF, WB |
| Species Reactivity: |
Human |
| Conjugation: |
APC |
| Alternative Names: |
T-cell surface glycoprotein CD5, Lymphocyte antigen 1, Ly-1, Lyt-1, CD5 antigen, CD 5, CD5 molecule, CD5 antigen (p56 62), CD5_HUMAN, LEU 1, LEU1, Ly12, LyA, Lymphocyte Antigen CD5, Lymphocyte antigen T1/Leu 1, Lymphocyte antigen T1/Leu-1, Lymphocyte glycoprotein T1/Leu1, OTTHUMP00000236973, p56 62, T1. |
| May act as a receptor in regulating T-cell proliferation. |
| Clonality: |
Recombinant |
| Concentration: |
Lot dependent |
| NCBI: |
921 |
| UniProt: |
P06127 |
| Buffer: |
Aqueous buffered solution containing 0.01M TBS (pH7.4) with 1% BSA, 0.02% Proclin300 and 50% Glycerol. |
| Source: |
KLH conjugated synthetic peptide derived from human CD5 |
| Purity: |
Purified by Protein A. |
| Target: |
CD5 |
| Antibody Type: |
Primary Antibody |
| Application Dilute: |
WB(WB(1:500-2000)), IF(IHC-P)(IF(IHC-P)(1:50-200)) |