Sibutramine HCl monohydrate - Bio-X (TM) - dangerous good and controlled substance, CAS [[125494-59-9]]
Catalog Number:
CBS-BS164401
| Article Name: |
Sibutramine HCl monohydrate - Bio-X (TM) - dangerous good and controlled substance, CAS [[125494-59-9]] |
| Biozol Catalog Number: |
CBS-BS164401 |
| Supplier Catalog Number: |
BS164401 |
| Alternative Catalog Number: |
CBS-BS164401-10MG |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Alternative Names: |
BTS-54524, reductil, meridia |
| Molecular Weight: |
334.32 g/mol |
| Sequence: |
CC(C)CC(C1(CCC1)C2=CC=C(C=C2)Cl)N(C)C.O.Cl |
| CAS Number: |
[125494-59-9] |
| Formula: |
C17H29Cl2NO |