Aldol 484 acetate, Biosynth Patent: EP 2427431 and US 8940909, CAS [[2484872-55-9]]
Catalog Number:
CBS-EA175348
| Article Name: |
Aldol 484 acetate, Biosynth Patent: EP 2427431 and US 8940909, CAS [[2484872-55-9]] |
| Biozol Catalog Number: |
CBS-EA175348 |
| Supplier Catalog Number: |
EA175348 |
| Alternative Catalog Number: |
CBS-EA175348-1G,CBS-EA175348-2.5G,CBS-EA175348-5G,CBS-EA175348-10G |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Molecular Weight: |
410.83 g/mol |
| Sequence: |
CC(=O)Oc1cn(c2cc(F)ccc2C(=O)c3cccn3C)c4cc(Cl)ccc14 |
| CAS Number: |
[2484872-55-9] |
| Formula: |
C22H16ClFN2O3 |