Aldol 458 nonanoate solution, 0.75 M in DMSO, Biosynth Patent: EP 2427431 and US 8940909, CAS [[2484873-15-4]]
Catalog Number:
CBS-EA175359
| Article Name: |
Aldol 458 nonanoate solution, 0.75 M in DMSO, Biosynth Patent: EP 2427431 and US 8940909, CAS [[2484873-15-4]] |
| Biozol Catalog Number: |
CBS-EA175359 |
| Supplier Catalog Number: |
EA175359 |
| Alternative Catalog Number: |
CBS-EA175359-1G, CBS-EA175359-2.5G, CBS-EA175359-5G, CBS-EA175359-10G |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Molecular Weight: |
407.51 g/mol |
| Sequence: |
O=C(OC)C1=CC=CC=C1N2C=C(OC(CCCCCCCC)=O)C3=C2C=CC=C3 |
| CAS Number: |
[2484873-15-4] |
| Formula: |
C25H29NO4 |