[(N-Acryloylamino)phenyl]mercuric chloride - dangerous good and controlled substance, CAS [[72136-45-9]]
Catalog Number:
CBS-FA17210
| Article Name: |
[(N-Acryloylamino)phenyl]mercuric chloride - dangerous good and controlled substance, CAS [[72136-45-9]] |
| Biozol Catalog Number: |
CBS-FA17210 |
| Supplier Catalog Number: |
FA17210 |
| Alternative Catalog Number: |
CBS-FA17210-1MG, CBS-FA17210-2MG, CBS-FA17210-5MG, CBS-FA17210-10MG, CBS-FA17210-25MG |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Alternative Names: |
Chloro[4-[(1-oxo-2-propen-1-yl)amino]phenyl]mercury,N-Phenyl-2-propenamide mercury complex,APM |
| Molecular Weight: |
382.21 g/mol |
| Sequence: |
C=CC(=O)NC1=CC=C(C=C1)[Hg]Cl |
| CAS Number: |
[72136-45-9] |
| Formula: |
C9H8ClHgNO |