4-tert-Butylcalix[4]arene - contains 12% residual solvent (ethyl acetate and acetonitrile), CAS [[60705-62-6]]
Catalog Number:
CBS-FB59591
| Article Name: |
4-tert-Butylcalix[4]arene - contains 12% residual solvent (ethyl acetate and acetonitrile), CAS [[60705-62-6]] |
| Biozol Catalog Number: |
CBS-FB59591 |
| Supplier Catalog Number: |
FB59591 |
| Alternative Catalog Number: |
CBS-FB59591-100G, CBS-FB59591-250G, CBS-FB59591-500G, CBS-FB59591-1000G |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Molecular Weight: |
648.91 g/mol |
| Sequence: |
CC(C)(C)C1=CC2=C(C(=C1)CC3=CC(=CC(=C3O)CC4=CC(=CC(=C4O)CC5=C(C(=CC(=C5)C(C)(C)C)C2)O)C(C)(C)C)C(C)(C)C)O |
| CAS Number: |
[60705-62-6] |
| Formula: |
C44H56O4 |