Clenbuterol hydrochloride - dangerous good and controlled substance, CAS [[21898-19-1]]
Catalog Number:
CBS-FC156780
| Article Name: |
Clenbuterol hydrochloride - dangerous good and controlled substance, CAS [[21898-19-1]] |
| Biozol Catalog Number: |
CBS-FC156780 |
| Supplier Catalog Number: |
FC156780 |
| Alternative Catalog Number: |
CBS-FC156780-0.025G, CBS-FC156780-0.05G, CBS-FC156780-0.1G, CBS-FC156780-0.25G, CBS-FC156780-0.5G |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Molecular Weight: |
313.65 g/mol |
| Sequence: |
ClC1=C(N)C(Cl)=CC(C(O)CNC(C)(C)C)=C1.Cl |
| CAS Number: |
[21898-19-1] |
| Formula: |
C12H18Cl2N2OHCl |