Desmethyl-8-bromo dragonfly hydrochloride - dangerous good and controlled substance, CAS [[178557-21-6]]
Catalog Number:
CBS-FD21356
| Article Name: |
Desmethyl-8-bromo dragonfly hydrochloride - dangerous good and controlled substance, CAS [[178557-21-6]] |
| Biozol Catalog Number: |
CBS-FD21356 |
| Supplier Catalog Number: |
FD21356 |
| Alternative Catalog Number: |
CBS-FD21356-1MG,CBS-FD21356-2MG,CBS-FD21356-5MG,CBS-FD21356-10MG |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Alternative Names: |
8-Bromo-2,3,6,7-tetrahydrobenzo[1,2-b:4,5-b]difuran-4-ethanamine hydrochloride |
| Molecular Weight: |
320.61 g/mol |
| Sequence: |
C1COC2=C(C3=C(C(=C21)CCN)OCC3)Br |
| CAS Number: |
[178557-21-6] |
| Formula: |
C12H15BrClNO2 |