1,1,2,2,3,3,3-Heptafluoro-n,n-bis(1,1,2,2,3,3,3-heptafluoropropyl)-1-propanamine - dangerous good and controlled substance, CAS [[338-83-0]]
Catalog Number:
CBS-FH106300
| Article Name: |
1,1,2,2,3,3,3-Heptafluoro-n,n-bis(1,1,2,2,3,3,3-heptafluoropropyl)-1-propanamine - dangerous good and controlled substance, CAS [[338-83-0]] |
| Biozol Catalog Number: |
CBS-FH106300 |
| Supplier Catalog Number: |
FH106300 |
| Alternative Catalog Number: |
CBS-FH106300-10G, CBS-FH106300-25G, CBS-FH106300-50G |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Alternative Names: |
Perfluorotripropylamine (mixture of isomers) |
| Molecular Weight: |
521.07 g/mol |
| Sequence: |
C(C(N(C(C(C(F)(F)F)(F)F)(F)F)C(C(C(F)(F)F)(F)F)(F)F)(F)F)(C(F)(F)F)(F)F |
| CAS Number: |
[338-83-0] |
| Formula: |
C9F21N |