Mercury(II) bis(dithizonate) - dangerous good and controlled substance, CAS [[14783-59-6]]
Catalog Number:
CBS-FM25107
| Article Name: |
Mercury(II) bis(dithizonate) - dangerous good and controlled substance, CAS [[14783-59-6]] |
| Biozol Catalog Number: |
CBS-FM25107 |
| Supplier Catalog Number: |
FM25107 |
| Alternative Catalog Number: |
CBS-FM25107-250MG,CBS-FM25107-500MG,CBS-FM25107-1000MG,CBS-FM25107-2000MG |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Alternative Names: |
Bis(dithizonato)mercury,Mercury 2-phenylhydrazidato]-bis[(phenylazo)thioformic acid,Mercuric bis(diphenylthiocarbazone) |
| Molecular Weight: |
711.23 g/mol |
| Sequence: |
C1=CC=C(C=C1)N/N=C(\[S-])/N=NC2=CC=CC=C2.C1=CC=C(C=C1)N/N=C(\[S-])/N=NC2=CC=CC=C2.[Hg+2] |
| CAS Number: |
[14783-59-6] |
| Formula: |
C26H22HgN8S2 |